C20H23F3N2O2 — CID 113188623
N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 113188623) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113188623 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CC(=O)N(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C20H23F3N2O2/c21-20(22,23)16-7-4-8-17(12-16)25-13-15(11-18(25)26)19(27)24-10-9-14-5-2-1-3-6-14/h4-5,7-8,12,15H,1-3,6,9-11,13H2,(H,24,27) |
| InChIKey | YVCVGRDPKVNHGW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|