C23H21F3N4O3 — CID 42651319
N-[2-[[5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbonyl]amino]ethyl]-1H-indole-6-carboxamide (PubChem CID 42651319) has the molecular formula C23H21F3N4O3 and a molecular weight of 458.44 g/mol. Its IUPAC name is N-[2-[[5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbonyl]amino]ethyl]-1H-indole-6-carboxamide.
| Compound Name | N-[2-[[5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbonyl]amino]ethyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 42651319 |
| Molecular Formula | C23H21F3N4O3 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-[2-[[5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carbonyl]amino]ethyl]-1H-indole-6-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CC(=O)N(c2cccc(C(F)(F)F)c2)C1)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C23H21F3N4O3/c24-23(25,26)17-2-1-3-18(12-17)30-13-16(11-20(30)31)22(33)29-9-8-28-21(32)15-5-4-14-6-7-27-19(14)10-15/h1-7,10,12,16,27H,8-9,11,13H2,(H,28,32)(H,29,33) |
| InChIKey | SOQBLSDMSUGVBN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|