C27H30F3N3OS — CID 44527073
N-[[1-[[4-(dimethylamino)phenyl]methyl]piperidin-3-yl]methyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 44527073) has the molecular formula C27H30F3N3OS and a molecular weight of 501.62 g/mol. Its IUPAC name is N-[[1-[[4-(dimethylamino)phenyl]methyl]piperidin-3-yl]methyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[[1-[[4-(dimethylamino)phenyl]methyl]piperidin-3-yl]methyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 44527073 |
| Molecular Formula | C27H30F3N3OS |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | N-[[1-[[4-(dimethylamino)phenyl]methyl]piperidin-3-yl]methyl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | CN(C)c1ccc(CN2CCCC(CNC(=O)c3ccc(-c4cccc(C(F)(F)F)c4)s3)C2)cc1 |
| InChI | InChI=1S/C27H30F3N3OS/c1-32(2)23-10-8-19(9-11-23)17-33-14-4-5-20(18-33)16-31-26(34)25-13-12-24(35-25)21-6-3-7-22(15-21)27(28,29)30/h3,6-13,15,20H,4-5,14,16-18H2,1-2H3,(H,31,34) |
| InChIKey | BHCISHNPDMDPJO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|