C19H23N3O3S — CID 126431934
5-[3-[[(2S)-1-amino-1-oxohexan-2-yl]carbamoyl]phenyl]-N-methylthiophene-2-carboxamide (PubChem CID 126431934) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 5-[3-[[(2S)-1-amino-1-oxohexan-2-yl]carbamoyl]phenyl]-N-methylthiophene-2-carboxamide.
| Compound Name | 5-[3-[[(2S)-1-amino-1-oxohexan-2-yl]carbamoyl]phenyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 126431934 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 5-[3-[[(2S)-1-amino-1-oxohexan-2-yl]carbamoyl]phenyl]-N-methylthiophene-2-carboxamide |
| SMILES | CCCC[C@H](NC(=O)c1cccc(-c2ccc(C(=O)NC)s2)c1)C(N)=O |
| InChI | InChI=1S/C19H23N3O3S/c1-3-4-8-14(17(20)23)22-18(24)13-7-5-6-12(11-13)15-9-10-16(26-15)19(25)21-2/h5-7,9-11,14H,3-4,8H2,1-2H3,(H2,20,23)(H,21,25)(H,22,24)/t14-/m0/s1 |
| InChIKey | KKXMWFDUDHJMDP-AWEZNQCLSA-N |
| XLogP | 2.55 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |