C16H16N2O4S — CID 143394412
(4S)-5-amino-5-oxo-4-[(5-phenylthiophene-2-carbonyl)amino]pentanoic acid (PubChem CID 143394412) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is (4S)-5-amino-5-oxo-4-[(5-phenylthiophene-2-carbonyl)amino]pentanoic acid.
| Compound Name | (4S)-5-amino-5-oxo-4-[(5-phenylthiophene-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 143394412 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (4S)-5-amino-5-oxo-4-[(5-phenylthiophene-2-carbonyl)amino]pentanoic acid |
| SMILES | NC(=O)[C@H](CCC(=O)O)NC(=O)c1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C16H16N2O4S/c17-15(21)11(6-9-14(19)20)18-16(22)13-8-7-12(23-13)10-4-2-1-3-5-10/h1-5,7-8,11H,6,9H2,(H2,17,21)(H,18,22)(H,19,20)/t11-/m0/s1 |
| InChIKey | PPVKSYANZJNJMS-NSHDSACASA-N |
| XLogP | 1.86 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |