C21H20ClNOS — CID 92762194
5-(3-chlorophenyl)-N-[(2S)-4-phenylbutan-2-yl]thiophene-2-carboxamide (PubChem CID 92762194) has the molecular formula C21H20ClNOS and a molecular weight of 369.92 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[(2S)-4-phenylbutan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[(2S)-4-phenylbutan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 92762194 |
| Molecular Formula | C21H20ClNOS |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[(2S)-4-phenylbutan-2-yl]thiophene-2-carboxamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)c1ccc(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C21H20ClNOS/c1-15(10-11-16-6-3-2-4-7-16)23-21(24)20-13-12-19(25-20)17-8-5-9-18(22)14-17/h2-9,12-15H,10-11H2,1H3,(H,23,24)/t15-/m0/s1 |
| InChIKey | BSKQMLJDZAIRJJ-HNNXBMFYSA-N |
| XLogP | 5.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |