C22H19ClN2OS — CID 46256134
4-chloro-N-(4-phenylbutan-2-yl)thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 46256134) has the molecular formula C22H19ClN2OS and a molecular weight of 394.93 g/mol. Its IUPAC name is 4-chloro-N-(4-phenylbutan-2-yl)thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-(4-phenylbutan-2-yl)thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 46256134 |
| Molecular Formula | C22H19ClN2OS |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 4-chloro-N-(4-phenylbutan-2-yl)thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)c1cc2c(Cl)nc3ccccc3c2s1 |
| InChI | InChI=1S/C22H19ClN2OS/c1-14(11-12-15-7-3-2-4-8-15)24-22(26)19-13-17-20(27-19)16-9-5-6-10-18(16)25-21(17)23/h2-10,13-14H,11-12H2,1H3,(H,24,26) |
| InChIKey | OCHFQKWWWXDUND-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|