C19H12ClFN2OS — CID 46256044
4-chloro-N-[(4-fluorophenyl)methyl]thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 46256044) has the molecular formula C19H12ClFN2OS and a molecular weight of 370.84 g/mol. Its IUPAC name is 4-chloro-N-[(4-fluorophenyl)methyl]thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-[(4-fluorophenyl)methyl]thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 46256044 |
| Molecular Formula | C19H12ClFN2OS |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 4-chloro-N-[(4-fluorophenyl)methyl]thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cc2c(Cl)nc3ccccc3c2s1 |
| InChI | InChI=1S/C19H12ClFN2OS/c20-18-14-9-16(19(24)22-10-11-5-7-12(21)8-6-11)25-17(14)13-3-1-2-4-15(13)23-18/h1-9H,10H2,(H,22,24) |
| InChIKey | AFBTZAVOODDPPS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|