C20H15FN4O2S — CID 68824358
N-benzyl-3-[(4-fluorobenzoyl)amino]-1H-thieno[3,2-c]pyrazole-5-carboxamide (PubChem CID 68824358) has the molecular formula C20H15FN4O2S and a molecular weight of 394.43 g/mol. Its IUPAC name is N-benzyl-3-[(4-fluorobenzoyl)amino]-1H-thieno[3,2-c]pyrazole-5-carboxamide.
| Compound Name | N-benzyl-3-[(4-fluorobenzoyl)amino]-1H-thieno[3,2-c]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 68824358 |
| Molecular Formula | C20H15FN4O2S |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-benzyl-3-[(4-fluorobenzoyl)amino]-1H-thieno[3,2-c]pyrazole-5-carboxamide |
| SMILES | O=C(Nc1n[nH]c2cc(C(=O)NCc3ccccc3)sc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15FN4O2S/c21-14-8-6-13(7-9-14)19(26)23-18-17-15(24-25-18)10-16(28-17)20(27)22-11-12-4-2-1-3-5-12/h1-10H,11H2,(H,22,27)(H2,23,24,25,26) |
| InChIKey | JFOANWYTMDNEHL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |