C19H14F4N4O2 — CID 58810200
N-benzyl-3-[[5-fluoro-2-(trifluoromethyl)benzoyl]amino]-1H-pyrazole-5-carboxamide (PubChem CID 58810200) has the molecular formula C19H14F4N4O2 and a molecular weight of 406.34 g/mol. Its IUPAC name is N-benzyl-3-[[5-fluoro-2-(trifluoromethyl)benzoyl]amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-benzyl-3-[[5-fluoro-2-(trifluoromethyl)benzoyl]amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 58810200 |
| Molecular Formula | C19H14F4N4O2 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-benzyl-3-[[5-fluoro-2-(trifluoromethyl)benzoyl]amino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cc(NC(=O)c2cc(F)ccc2C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C19H14F4N4O2/c20-12-6-7-14(19(21,22)23)13(8-12)17(28)25-16-9-15(26-27-16)18(29)24-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,24,29)(H2,25,26,27,28) |
| InChIKey | UCOLPRSPCAKGQB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |