C18H14ClF2N5NaO2 — CID 87764208
CID 87764208 (PubChem CID 87764208) has the molecular formula C18H14ClF2N5NaO2 and a molecular weight of 428.78 g/mol.
| Compound Name | CID 87764208 |
|---|---|
| PubChem CID | 87764208 |
| Molecular Formula | C18H14ClF2N5NaO2 |
| Molecular Weight | 428.78 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | — |
| SMILES | Cc1cc(F)c(F)cc1C(=O)Nc1cc(C(=O)NCc2ccc(Cl)nc2)[nH]n1.[Na] |
| InChI | InChI=1S/C18H14ClF2N5O2.Na/c1-9-4-12(20)13(21)5-11(9)17(27)24-16-6-14(25-26-16)18(28)23-8-10-2-3-15(19)22-7-10;/h2-7H,8H2,1H3,(H,23,28)(H2,24,25,26,27); |
| InChIKey | SUZNDIDHKIQSPB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|