C17H14ClF2N5O2S — CID 58810350
3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 58810350) has the molecular formula C17H14ClF2N5O2S and a molecular weight of 425.85 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 58810350 |
| Molecular Formula | C17H14ClF2N5O2S |
| Molecular Weight | 425.85 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(2,5-dimethyl-1,3-thiazol-4-yl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1nc(CNC(=O)c2cc(NC(=O)c3cc(F)c(F)cc3Cl)n[nH]2)c(C)s1 |
| InChI | InChI=1S/C17H14ClF2N5O2S/c1-7-14(22-8(2)28-7)6-21-17(27)13-5-15(25-24-13)23-16(26)9-3-11(19)12(20)4-10(9)18/h3-5H,6H2,1-2H3,(H,21,27)(H2,23,24,25,26) |
| InChIKey | FNUPFTFDAOOLMP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|