C21H20ClF2N5O — CID 143337595
2-chloro-N-[5-[1-[(4-ethyl-6-methyl-3-pyridinyl)methylamino]ethenyl]-1H-pyrazol-3-yl]-4,5-difluorobenzamide (PubChem CID 143337595) has the molecular formula C21H20ClF2N5O and a molecular weight of 431.87 g/mol. Its IUPAC name is 2-chloro-N-[5-[1-[(4-ethyl-6-methyl-3-pyridinyl)methylamino]ethenyl]-1H-pyrazol-3-yl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[5-[1-[(4-ethyl-6-methyl-3-pyridinyl)methylamino]ethenyl]-1H-pyrazol-3-yl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 143337595 |
| Molecular Formula | C21H20ClF2N5O |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-chloro-N-[5-[1-[(4-ethyl-6-methyl-3-pyridinyl)methylamino]ethenyl]-1H-pyrazol-3-yl]-4,5-difluorobenzamide |
| SMILES | C=C(NCc1cnc(C)cc1CC)c1cc(NC(=O)c2cc(F)c(F)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C21H20ClF2N5O/c1-4-13-5-11(2)25-9-14(13)10-26-12(3)19-8-20(29-28-19)27-21(30)15-6-17(23)18(24)7-16(15)22/h5-9,26H,3-4,10H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | UXKHUYMHZWVUQG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|