C19H23ClF2N4O3 — CID 15948822
3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-(2-methoxyethyl)-N-pentan-3-yl-1H-pyrazole-5-carboxamide (PubChem CID 15948822) has the molecular formula C19H23ClF2N4O3 and a molecular weight of 428.87 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-(2-methoxyethyl)-N-pentan-3-yl-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-(2-methoxyethyl)-N-pentan-3-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 15948822 |
| Molecular Formula | C19H23ClF2N4O3 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-(2-methoxyethyl)-N-pentan-3-yl-1H-pyrazole-5-carboxamide |
| SMILES | CCC(CC)N(CCOC)C(=O)c1cc(NC(=O)c2cc(F)c(F)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C19H23ClF2N4O3/c1-4-11(5-2)26(6-7-29-3)19(28)16-10-17(25-24-16)23-18(27)12-8-14(21)15(22)9-13(12)20/h8-11H,4-7H2,1-3H3,(H2,23,24,25,27) |
| InChIKey | RHRXGCLNHSBCTD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|