C19H12ClF2N5O2S — CID 15948358
N-(1,3-benzothiazol-2-ylmethyl)-3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 15948358) has the molecular formula C19H12ClF2N5O2S and a molecular weight of 447.85 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 15948358 |
| Molecular Formula | C19H12ClF2N5O2S |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2s1)c1cc(NC(=O)c2cc(F)c(F)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C19H12ClF2N5O2S/c20-10-6-12(22)11(21)5-9(10)18(28)25-16-7-14(26-27-16)19(29)23-8-17-24-13-3-1-2-4-15(13)30-17/h1-7H,8H2,(H,23,29)(H2,25,26,27,28) |
| InChIKey | GRGPJNXKFSFJML-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|