C22H21ClF2N6O3 — CID 15947256
3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[[6-(4-hydroxypiperidin-1-yl)-3-pyridinyl]methyl]-1H-pyrazole-5-carboxamide (PubChem CID 15947256) has the molecular formula C22H21ClF2N6O3 and a molecular weight of 490.90 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[[6-(4-hydroxypiperidin-1-yl)-3-pyridinyl]methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[[6-(4-hydroxypiperidin-1-yl)-3-pyridinyl]methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 15947256 |
| Molecular Formula | C22H21ClF2N6O3 |
| Molecular Weight | 490.90 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[[6-(4-hydroxypiperidin-1-yl)-3-pyridinyl]methyl]-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCC(O)CC2)nc1)c1cc(NC(=O)c2cc(F)c(F)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C22H21ClF2N6O3/c23-15-8-17(25)16(24)7-14(15)21(33)28-19-9-18(29-30-19)22(34)27-11-12-1-2-20(26-10-12)31-5-3-13(32)4-6-31/h1-2,7-10,13,32H,3-6,11H2,(H,27,34)(H2,28,29,30,33) |
| InChIKey | ILVSITVOIQPTLH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.90 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|