C17H17ClF2N4O2 — CID 15948590
3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-cyclohexyl-1H-pyrazole-5-carboxamide (PubChem CID 15948590) has the molecular formula C17H17ClF2N4O2 and a molecular weight of 382.80 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-cyclohexyl-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-cyclohexyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 15948590 |
| Molecular Formula | C17H17ClF2N4O2 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-cyclohexyl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(NC(=O)c2cc(F)c(F)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C17H17ClF2N4O2/c18-11-7-13(20)12(19)6-10(11)16(25)22-15-8-14(23-24-15)17(26)21-9-4-2-1-3-5-9/h6-9H,1-5H2,(H,21,26)(H2,22,23,24,25) |
| InChIKey | DTLODKISMPAWMH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|