C18H14ClF2N5O3 — CID 58810334
3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(2-methoxy-3-pyridinyl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 58810334) has the molecular formula C18H14ClF2N5O3 and a molecular weight of 421.79 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(2-methoxy-3-pyridinyl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(2-methoxy-3-pyridinyl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 58810334 |
| Molecular Formula | C18H14ClF2N5O3 |
| Molecular Weight | 421.79 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(2-methoxy-3-pyridinyl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ncccc1CNC(=O)c1cc(NC(=O)c2cc(F)c(F)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C18H14ClF2N5O3/c1-29-18-9(3-2-4-22-18)8-23-17(28)14-7-15(26-25-14)24-16(27)10-5-12(20)13(21)6-11(10)19/h2-7H,8H2,1H3,(H,23,28)(H2,24,25,26,27) |
| InChIKey | DXFJRAMIGYWQAM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|