C22H21ClF2N6O2 — CID 58810283
3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[[3-[1-(dimethylamino)ethylideneamino]phenyl]methyl]-1H-pyrazole-5-carboxamide (PubChem CID 58810283) has the molecular formula C22H21ClF2N6O2 and a molecular weight of 474.90 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[[3-[1-(dimethylamino)ethylideneamino]phenyl]methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[[3-[1-(dimethylamino)ethylideneamino]phenyl]methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 58810283 |
| Molecular Formula | C22H21ClF2N6O2 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[[3-[1-(dimethylamino)ethylideneamino]phenyl]methyl]-1H-pyrazole-5-carboxamide |
| SMILES | C/C(=N\c1cccc(CNC(=O)c2cc(NC(=O)c3cc(F)c(F)cc3Cl)n[nH]2)c1)N(C)C |
| InChI | InChI=1S/C22H21ClF2N6O2/c1-12(31(2)3)27-14-6-4-5-13(7-14)11-26-22(33)19-10-20(30-29-19)28-21(32)15-8-17(24)18(25)9-16(15)23/h4-10H,11H2,1-3H3,(H,26,33)(H2,28,29,30,32)/b27-12+ |
| InChIKey | HGFQHOISCIJJBH-KKMKTNMSSA-N |
| XLogP | 4.14 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|