C20H17ClF2N6O2 — CID 58810250
N-[[3-(1-aminoethylideneamino)phenyl]methyl]-3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 58810250) has the molecular formula C20H17ClF2N6O2 and a molecular weight of 446.85 g/mol. Its IUPAC name is N-[[3-(1-aminoethylideneamino)phenyl]methyl]-3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[[3-(1-aminoethylideneamino)phenyl]methyl]-3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 58810250 |
| Molecular Formula | C20H17ClF2N6O2 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[[3-(1-aminoethylideneamino)phenyl]methyl]-3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | C/C(N)=N\c1cccc(CNC(=O)c2cc(NC(=O)c3cc(F)c(F)cc3Cl)n[nH]2)c1 |
| InChI | InChI=1S/C20H17ClF2N6O2/c1-10(24)26-12-4-2-3-11(5-12)9-25-20(31)17-8-18(29-28-17)27-19(30)13-6-15(22)16(23)7-14(13)21/h2-8H,9H2,1H3,(H2,24,26)(H,25,31)(H2,27,28,29,30) |
| InChIKey | DVVAHGYLSQFTLA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|