C18H16ClF2N5O3 — CID 15947474
3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(4-ethyl-2-methyl-1,3-oxazol-5-yl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 15947474) has the molecular formula C18H16ClF2N5O3 and a molecular weight of 423.81 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(4-ethyl-2-methyl-1,3-oxazol-5-yl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(4-ethyl-2-methyl-1,3-oxazol-5-yl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 15947474 |
| Molecular Formula | C18H16ClF2N5O3 |
| Molecular Weight | 423.81 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[(4-ethyl-2-methyl-1,3-oxazol-5-yl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | CCc1nc(C)oc1CNC(=O)c1cc(NC(=O)c2cc(F)c(F)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C18H16ClF2N5O3/c1-3-13-15(29-8(2)23-13)7-22-18(28)14-6-16(26-25-14)24-17(27)9-4-11(20)12(21)5-10(9)19/h4-6H,3,7H2,1-2H3,(H,22,28)(H2,24,25,26,27) |
| InChIKey | KIMAPIPPEGHTNQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|