C19H19ClN4O3 — CID 47036298
3-(2-chlorophenyl)-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-1H-pyrazole-5-carboxamide (PubChem CID 47036298) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 47036298 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-1H-pyrazole-5-carboxamide |
| SMILES | COCCOc1ncccc1CNC(=O)c1cc(-c2ccccc2Cl)n[nH]1 |
| InChI | InChI=1S/C19H19ClN4O3/c1-26-9-10-27-19-13(5-4-8-21-19)12-22-18(25)17-11-16(23-24-17)14-6-2-3-7-15(14)20/h2-8,11H,9-10,12H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | JFQUBOYVOWWGRV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|