C16H16FIN2O3 — CID 60616344
5-fluoro-2-iodo-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide (PubChem CID 60616344) has the molecular formula C16H16FIN2O3 and a molecular weight of 430.22 g/mol. Its IUPAC name is 5-fluoro-2-iodo-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide.
| Compound Name | 5-fluoro-2-iodo-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 60616344 |
| Molecular Formula | C16H16FIN2O3 |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | 5-fluoro-2-iodo-N-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide |
| SMILES | COCCOc1ncccc1CNC(=O)c1cc(F)ccc1I |
| InChI | InChI=1S/C16H16FIN2O3/c1-22-7-8-23-16-11(3-2-6-19-16)10-20-15(21)13-9-12(17)4-5-14(13)18/h2-6,9H,7-8,10H2,1H3,(H,20,21) |
| InChIKey | HIVRUFBEKNDJMA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|