C14H13IN2O2 — CID 38533778
2-iodo-N-[(2-methoxy-3-pyridinyl)methyl]benzamide (PubChem CID 38533778) has the molecular formula C14H13IN2O2 and a molecular weight of 368.17 g/mol. Its IUPAC name is 2-iodo-N-[(2-methoxy-3-pyridinyl)methyl]benzamide.
| Compound Name | 2-iodo-N-[(2-methoxy-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 38533778 |
| Molecular Formula | C14H13IN2O2 |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 2-iodo-N-[(2-methoxy-3-pyridinyl)methyl]benzamide |
| SMILES | COc1ncccc1CNC(=O)c1ccccc1I |
| InChI | InChI=1S/C14H13IN2O2/c1-19-14-10(5-4-8-16-14)9-17-13(18)11-6-2-3-7-12(11)15/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | AKGCGJXXUOXSIY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|