C14H11ClN6O — CID 78862068
3-(2-chlorophenyl)-N'-pyrimidin-2-yl-1H-pyrazole-5-carbohydrazide (PubChem CID 78862068) has the molecular formula C14H11ClN6O and a molecular weight of 314.74 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N'-pyrimidin-2-yl-1H-pyrazole-5-carbohydrazide.
| Compound Name | 3-(2-chlorophenyl)-N'-pyrimidin-2-yl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 78862068 |
| Molecular Formula | C14H11ClN6O |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-(2-chlorophenyl)-N'-pyrimidin-2-yl-1H-pyrazole-5-carbohydrazide |
| SMILES | O=C(NNc1ncccn1)c1cc(-c2ccccc2Cl)n[nH]1 |
| InChI | InChI=1S/C14H11ClN6O/c15-10-5-2-1-4-9(10)11-8-12(19-18-11)13(22)20-21-14-16-6-3-7-17-14/h1-8H,(H,18,19)(H,20,22)(H,16,17,21) |
| InChIKey | SXGYNYTZYPNPSA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|