C28H27ClF2N4O7 — CID 58810428
1-cyclohexyloxycarbonyloxyethyl 4-[[3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]-methylamino]benzoate (PubChem CID 58810428) has the molecular formula C28H27ClF2N4O7 and a molecular weight of 604.99 g/mol. Its IUPAC name is 1-cyclohexyloxycarbonyloxyethyl 4-[[3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]-methylamino]benzoate.
| Compound Name | 1-cyclohexyloxycarbonyloxyethyl 4-[[3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]-methylamino]benzoate |
|---|---|
| PubChem CID | 58810428 |
| Molecular Formula | C28H27ClF2N4O7 |
| Molecular Weight | 604.99 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | 1-cyclohexyloxycarbonyloxyethyl 4-[[3-[(2-chloro-4,5-difluorobenzoyl)amino]-1H-pyrazole-5-carbonyl]-methylamino]benzoate |
| SMILES | CC(OC(=O)OC1CCCCC1)OC(=O)c1ccc(N(C)C(=O)c2cc(NC(=O)c3cc(F)c(F)cc3Cl)n[nH]2)cc1 |
| InChI | InChI=1S/C28H27ClF2N4O7/c1-15(41-28(39)42-18-6-4-3-5-7-18)40-27(38)16-8-10-17(11-9-16)35(2)26(37)23-14-24(34-33-23)32-25(36)19-12-21(30)22(31)13-20(19)29/h8-15,18H,3-7H2,1-2H3,(H2,32,33,34,36) |
| InChIKey | OICQGIKLAAOOFN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.99 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|