C19H15ClF2N6O3 — CID 91049107
3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[4-(N'-hydroxycarbamimidoyl)phenyl]-N-methyl-1H-pyrazole-5-carboxamide (PubChem CID 91049107) has the molecular formula C19H15ClF2N6O3 and a molecular weight of 448.82 g/mol. Its IUPAC name is 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[4-(N'-hydroxycarbamimidoyl)phenyl]-N-methyl-1H-pyrazole-5-carboxamide.
| Compound Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[4-(N'-hydroxycarbamimidoyl)phenyl]-N-methyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 91049107 |
| Molecular Formula | C19H15ClF2N6O3 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 3-[(2-chloro-4,5-difluorobenzoyl)amino]-N-[4-(N'-hydroxycarbamimidoyl)phenyl]-N-methyl-1H-pyrazole-5-carboxamide |
| SMILES | CN(C(=O)c1cc(NC(=O)c2cc(F)c(F)cc2Cl)n[nH]1)c1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C19H15ClF2N6O3/c1-28(10-4-2-9(3-5-10)17(23)27-31)19(30)15-8-16(26-25-15)24-18(29)11-6-13(21)14(22)7-12(11)20/h2-8,31H,1H3,(H2,23,27)(H2,24,25,26,29) |
| InChIKey | ZGFHCWLBJRBDQY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|