C18H32IN5O — CID 111385049
2-[[N-[2-[benzyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide;hydroiodide (PubChem CID 111385049) has the molecular formula C18H32IN5O and a molecular weight of 461.39 g/mol. Its IUPAC name is 2-[[N-[2-[benzyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide;hydroiodide.
| Compound Name | 2-[[N-[2-[benzyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111385049 |
| Molecular Formula | C18H32IN5O |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-[[N-[2-[benzyl(methyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]-N-tert-butylacetamide;hydroiodide |
| SMILES | C/N=C(/NCCN(C)Cc1ccccc1)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C18H31N5O.HI/c1-18(2,3)22-16(24)13-21-17(19-4)20-11-12-23(5)14-15-9-7-6-8-10-15;/h6-10H,11-14H2,1-5H3,(H,22,24)(H2,19,20,21);1H |
| InChIKey | HHZPIAFBDBCCAZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|