C19H33N5O — CID 111382923
N-tert-butyl-2-[[N'-methyl-N-[4-(N-methylanilino)butyl]carbamimidoyl]amino]acetamide (PubChem CID 111382923) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[4-(N-methylanilino)butyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[4-(N-methylanilino)butyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111382923 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[4-(N-methylanilino)butyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCCCN(C)c1ccccc1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H33N5O/c1-19(2,3)23-17(25)15-22-18(20-4)21-13-9-10-14-24(5)16-11-7-6-8-12-16/h6-8,11-12H,9-10,13-15H2,1-5H3,(H,23,25)(H2,20,21,22) |
| InChIKey | FTMORWMHBRYNEV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|