C16H25F2IN4O — CID 111786642
N-tert-butyl-2-[[N-[2-(2,4-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111786642) has the molecular formula C16H25F2IN4O and a molecular weight of 454.30 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[2-(2,4-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-[2-(2,4-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111786642 |
| Molecular Formula | C16H25F2IN4O |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-tert-butyl-2-[[N-[2-(2,4-difluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(F)cc1F)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C16H24F2N4O.HI/c1-16(2,3)22-14(23)10-21-15(19-4)20-8-7-11-5-6-12(17)9-13(11)18;/h5-6,9H,7-8,10H2,1-4H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | PHZKKVAVCUTWAM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|