C18H30N4O — CID 111649380
N-tert-butyl-2-[[N-[2-(3,5-dimethylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111649380) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[2-(3,5-dimethylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-[2-(3,5-dimethylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111649380 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | N-tert-butyl-2-[[N-[2-(3,5-dimethylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCc1cc(C)cc(C)c1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H30N4O/c1-13-9-14(2)11-15(10-13)7-8-20-17(19-6)21-12-16(23)22-18(3,4)5/h9-11H,7-8,12H2,1-6H3,(H,22,23)(H2,19,20,21) |
| InChIKey | FDAKCPMTPXJKTL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|