C16H31N5S — CID 109488867
N'-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide (PubChem CID 109488867) has the molecular formula C16H31N5S and a molecular weight of 325.53 g/mol. Its IUPAC name is N'-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488867 |
| Molecular Formula | C16H31N5S |
| Molecular Weight | 325.53 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | N'-(1,4-diazabicyclo[2.2.2]octan-2-ylmethyl)-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\CC1CN2CCN1CC2)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C16H31N5S/c1-4-17-15(21-9-10-22-16(2,3)13-21)18-11-14-12-19-5-7-20(14)8-6-19/h14H,4-13H2,1-3H3,(H,17,18) |
| InChIKey | NAQWLKPENNZLKS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.53 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|