C18H34N4 — CID 111733879
N-ethyl-N'-[(1-ethylpyrrolidin-3-yl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide (PubChem CID 111733879) has the molecular formula C18H34N4 and a molecular weight of 306.50 g/mol. Its IUPAC name is N-ethyl-N'-[(1-ethylpyrrolidin-3-yl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide.
| Compound Name | N-ethyl-N'-[(1-ethylpyrrolidin-3-yl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide |
|---|---|
| PubChem CID | 111733879 |
| Molecular Formula | C18H34N4 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.28 |
| IUPAC Name | N-ethyl-N'-[(1-ethylpyrrolidin-3-yl)methyl]-2-azaspiro[4.4]nonane-2-carboximidamide |
| SMILES | CCN/C(=N\CC1CCN(CC)C1)N1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C18H34N4/c1-3-19-17(20-13-16-7-11-21(4-2)14-16)22-12-10-18(15-22)8-5-6-9-18/h16H,3-15H2,1-2H3,(H,19,20) |
| InChIKey | VXVNBOSNRWEAOG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|