C23H37IN4O — CID 111733902
N-ethyl-N'-[[1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide (PubChem CID 111733902) has the molecular formula C23H37IN4O and a molecular weight of 512.48 g/mol. Its IUPAC name is N-ethyl-N'-[[1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111733902 |
| Molecular Formula | C23H37IN4O |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | N-ethyl-N'-[[1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]-2-azaspiro[4.4]nonane-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(c2ccccc2OC)C1)N1CCC2(CCCC2)C1.I |
| InChI | InChI=1S/C23H36N4O.HI/c1-3-24-22(27-15-13-23(18-27)11-6-7-12-23)25-16-19-10-14-26(17-19)20-8-4-5-9-21(20)28-2;/h4-5,8-9,19H,3,6-7,10-18H2,1-2H3,(H,24,25);1H |
| InChIKey | PWVFVXXWUCSXCH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|