C19H28ClIN4O — CID 119152926
N'-[2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dihydropyrrol-1-yl)-N-ethylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 119152926) has the molecular formula C19H28ClIN4O and a molecular weight of 490.82 g/mol. Its IUPAC name is N'-[2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dihydropyrrol-1-yl)-N-ethylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dihydropyrrol-1-yl)-N-ethylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119152926 |
| Molecular Formula | C19H28ClIN4O |
| Molecular Weight | 490.82 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | N'-[2-(3-chlorophenyl)-2-hydroxyethyl]-3-(2,5-dihydropyrrol-1-yl)-N-ethylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(Cl)c1)N1CCC(N2CC=CC2)C1.I |
| InChI | InChI=1S/C19H27ClN4O.HI/c1-2-21-19(22-13-18(25)15-6-5-7-16(20)12-15)24-11-8-17(14-24)23-9-3-4-10-23;/h3-7,12,17-18,25H,2,8-11,13-14H2,1H3,(H,21,22);1H |
| InChIKey | FINZAAPLWCXJOS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.82 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|