C18H36N6O — CID 111725819
N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide (PubChem CID 111725819) has the molecular formula C18H36N6O and a molecular weight of 352.53 g/mol. Its IUPAC name is N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111725819 |
| Molecular Formula | C18H36N6O |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | N'-methyl-N-[2-(4-methylpiperazin-1-yl)propyl]-3-morpholin-4-ylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)N1CCN(C)CC1)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C18H36N6O/c1-16(22-8-6-21(3)7-9-22)14-20-18(19-2)24-5-4-17(15-24)23-10-12-25-13-11-23/h16-17H,4-15H2,1-3H3,(H,19,20) |
| InChIKey | CMIZOXZQKGYPFF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 46.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|