C27H34N4O2 — CID 111263425
3-[[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 111263425) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 3-[[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 111263425 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 3-[[[ethylamino-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCC2CCCO2)c1)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H34N4O2/c1-2-28-27(31-15-13-23(14-16-31)22-9-4-3-5-10-22)30-19-21-8-6-11-24(18-21)26(32)29-20-25-12-7-17-33-25/h3-6,8-11,13,18,25H,2,7,12,14-17,19-20H2,1H3,(H,28,30)(H,29,32) |
| InChIKey | KHJIOVKWNHAVBF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|