C23H37IN4O2 — CID 111255982
3-[[[ethylamino-[(4-methylcyclohexyl)amino]methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide;hydroiodide (PubChem CID 111255982) has the molecular formula C23H37IN4O2 and a molecular weight of 528.48 g/mol. Its IUPAC name is 3-[[[ethylamino-[(4-methylcyclohexyl)amino]methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide;hydroiodide.
| Compound Name | 3-[[[ethylamino-[(4-methylcyclohexyl)amino]methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 111255982 |
| Molecular Formula | C23H37IN4O2 |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 3-[[[ethylamino-[(4-methylcyclohexyl)amino]methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCC2CCCO2)c1)NC1CCC(C)CC1.I |
| InChI | InChI=1S/C23H36N4O2.HI/c1-3-24-23(27-20-11-9-17(2)10-12-20)26-15-18-6-4-7-19(14-18)22(28)25-16-21-8-5-13-29-21;/h4,6-7,14,17,20-21H,3,5,8-13,15-16H2,1-2H3,(H,25,28)(H2,24,26,27);1H |
| InChIKey | YWHDDGFZAMIWAM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|