C21H34N4O2S — CID 111628706
3-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 111628706) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is 3-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 111628706 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 3-[[[ethylamino-(4-methylsulfanylbutylamino)methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCC2CCCO2)c1)NCCCCSC |
| InChI | InChI=1S/C21H34N4O2S/c1-3-22-21(23-11-4-5-13-28-2)25-15-17-8-6-9-18(14-17)20(26)24-16-19-10-7-12-27-19/h6,8-9,14,19H,3-5,7,10-13,15-16H2,1-2H3,(H,24,26)(H2,22,23,25) |
| InChIKey | ZOGULCVKBCNHNS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|