C23H30FIN4O2 — CID 111877280
3-[[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide;hydroiodide (PubChem CID 111877280) has the molecular formula C23H30FIN4O2 and a molecular weight of 540.42 g/mol. Its IUPAC name is 3-[[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide;hydroiodide.
| Compound Name | 3-[[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 111877280 |
| Molecular Formula | C23H30FIN4O2 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 3-[[[N-ethyl-N'-[(3-fluorophenyl)methyl]carbamimidoyl]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NCc1cccc(C(=O)NCC2CCCO2)c1.I |
| InChI | InChI=1S/C23H29FN4O2.HI/c1-2-25-23(28-15-18-7-4-9-20(24)13-18)27-14-17-6-3-8-19(12-17)22(29)26-16-21-10-5-11-30-21;/h3-4,6-9,12-13,21H,2,5,10-11,14-16H2,1H3,(H,26,29)(H2,25,27,28);1H |
| InChIKey | HPLKEJLMDTUSLT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|