C24H34N4O2S — CID 111674052
3-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 111674052) has the molecular formula C24H34N4O2S and a molecular weight of 442.63 g/mol. Its IUPAC name is 3-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 111674052 |
| Molecular Formula | C24H34N4O2S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 3-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCC2CCCO2)c1)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C24H34N4O2S/c1-3-25-24(27-15-18(2)13-22-10-6-12-31-22)28-16-19-7-4-8-20(14-19)23(29)26-17-21-9-5-11-30-21/h4,6-8,10,12,14,18,21H,3,5,9,11,13,15-17H2,1-2H3,(H,26,29)(H2,25,27,28) |
| InChIKey | HOPRWOLBNDFPOS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|