C15H29IN4O2S — CID 111164826
ethyl 4-[N-ethyl-N'-(2-prop-2-enylsulfanylethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164826) has the molecular formula C15H29IN4O2S and a molecular weight of 456.39 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-(2-prop-2-enylsulfanylethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-(2-prop-2-enylsulfanylethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164826 |
| Molecular Formula | C15H29IN4O2S |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-(2-prop-2-enylsulfanylethyl)carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | C=CCSCC/N=C(\NCC)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C15H28N4O2S.HI/c1-4-12-22-13-7-17-14(16-5-2)18-8-10-19(11-9-18)15(20)21-6-3;/h4H,1,5-13H2,2-3H3,(H,16,17);1H |
| InChIKey | NWRVGVSLXJKCMQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|