C15H32IN5O4S — CID 111164592
ethyl 4-[N-ethyl-N'-[3-(ethylsulfonylamino)propyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164592) has the molecular formula C15H32IN5O4S and a molecular weight of 505.42 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[3-(ethylsulfonylamino)propyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-[3-(ethylsulfonylamino)propyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164592 |
| Molecular Formula | C15H32IN5O4S |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[3-(ethylsulfonylamino)propyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCNS(=O)(=O)CC)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C15H31N5O4S.HI/c1-4-16-14(17-8-7-9-18-25(22,23)6-3)19-10-12-20(13-11-19)15(21)24-5-2;/h18H,4-13H2,1-3H3,(H,16,17);1H |
| InChIKey | XNTPIBSMZAQGCF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|