C23H30FN5O2 — CID 111165818
2-[4-[2-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]ethyl]phenoxy]acetamide (PubChem CID 111165818) has the molecular formula C23H30FN5O2 and a molecular weight of 427.52 g/mol. Its IUPAC name is 2-[4-[2-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]ethyl]phenoxy]acetamide.
| Compound Name | 2-[4-[2-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 111165818 |
| Molecular Formula | C23H30FN5O2 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 2-[4-[2-[[ethylamino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]ethyl]phenoxy]acetamide |
| SMILES | CCN/C(=N\CCc1ccc(OCC(N)=O)cc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H30FN5O2/c1-2-26-23(27-12-11-18-3-9-21(10-4-18)31-17-22(25)30)29-15-13-28(14-16-29)20-7-5-19(24)6-8-20/h3-10H,2,11-17H2,1H3,(H2,25,30)(H,26,27) |
| InChIKey | PBLFJEAUNAUCRJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|