C19H28N4O3 — CID 111671632
1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine (PubChem CID 111671632) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
|---|---|
| PubChem CID | 111671632 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]-3-[4-(2-oxo-1-pyridinyl)butyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCCCn1ccccc1=O |
| InChI | InChI=1S/C19H28N4O3/c1-3-20-18(22-15-19(2,25)16-9-8-14-26-16)21-11-5-7-13-23-12-6-4-10-17(23)24/h4,6,8-10,12,14,25H,3,5,7,11,13,15H2,1-2H3,(H2,20,21,22) |
| InChIKey | CUWGJKXMRGKZKQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|