C19H30BrIN4OS — CID 111527716
4-[[N-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-cyclopropylbutanamide;hydroiodide (PubChem CID 111527716) has the molecular formula C19H30BrIN4OS and a molecular weight of 569.35 g/mol. Its IUPAC name is 4-[[N-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-cyclopropylbutanamide;hydroiodide.
| Compound Name | 4-[[N-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-cyclopropylbutanamide;hydroiodide |
|---|---|
| PubChem CID | 111527716 |
| Molecular Formula | C19H30BrIN4OS |
| Molecular Weight | 569.35 g/mol |
| Exact Mass | 568.04 |
| IUPAC Name | 4-[[N-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-N'-methylcarbamimidoyl]amino]-N-cyclopropylbutanamide;hydroiodide |
| SMILES | C/N=C(\NCCCC(=O)NC1CC1)NCC(C)(C)Sc1ccc(Br)cc1.I |
| InChI | InChI=1S/C19H29BrN4OS.HI/c1-19(2,26-16-10-6-14(20)7-11-16)13-23-18(21-3)22-12-4-5-17(25)24-15-8-9-15;/h6-7,10-11,15H,4-5,8-9,12-13H2,1-3H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | IDQGIXJJOARGSI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|