C17H33IN4O — CID 110036202
N,N-dimethyl-2-[[[(1-methylcycloheptyl)methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110036202) has the molecular formula C17H33IN4O and a molecular weight of 436.38 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(1-methylcycloheptyl)methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[(1-methylcycloheptyl)methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110036202 |
| Molecular Formula | C17H33IN4O |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N,N-dimethyl-2-[[[(1-methylcycloheptyl)methylamino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)NCC1(C)CCCCCC1.I |
| InChI | InChI=1S/C17H32N4O.HI/c1-5-12-18-16(19-13-15(22)21(3)4)20-14-17(2)10-8-6-7-9-11-17;/h5H,1,6-14H2,2-4H3,(H2,18,19,20);1H |
| InChIKey | XUOJRYTZZRGXCX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|