C11H15NO2S — CID 115184040
1-(hydroxymethyl)-N-(thiophen-2-ylmethyl)cyclobutane-1-carboxamide (PubChem CID 115184040) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 1-(hydroxymethyl)-N-(thiophen-2-ylmethyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(hydroxymethyl)-N-(thiophen-2-ylmethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 115184040 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 1-(hydroxymethyl)-N-(thiophen-2-ylmethyl)cyclobutane-1-carboxamide |
| SMILES | O=C(NCc1cccs1)C1(CO)CCC1 |
| InChI | InChI=1S/C11H15NO2S/c13-8-11(4-2-5-11)10(14)12-7-9-3-1-6-15-9/h1,3,6,13H,2,4-5,7-8H2,(H,12,14) |
| InChIKey | JXDDDSYIIFIJSZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |