C15H20N2OS — CID 68850926
N-(1,3-thiazol-5-ylmethyl)adamantane-1-carboxamide (PubChem CID 68850926) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is N-(1,3-thiazol-5-ylmethyl)adamantane-1-carboxamide.
| Compound Name | N-(1,3-thiazol-5-ylmethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 68850926 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(1,3-thiazol-5-ylmethyl)adamantane-1-carboxamide |
| SMILES | O=C(NCc1cncs1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H20N2OS/c18-14(17-8-13-7-16-9-19-13)15-4-10-1-11(5-15)3-12(2-10)6-15/h7,9-12H,1-6,8H2,(H,17,18) |
| InChIKey | VUKKOJRSEUMMKQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |