C18H20BrClN2O3 — CID 2124189
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate (PubChem CID 2124189) has the molecular formula C18H20BrClN2O3 and a molecular weight of 427.73 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 2124189 |
| Molecular Formula | C18H20BrClN2O3 |
| Molecular Weight | 427.73 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (5S,7R)-3-bromoadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@@H]3C[C@@H](CC(Br)(C3)C1)C2)Nc1cccnc1Cl |
| InChI | InChI=1S/C18H20BrClN2O3/c19-18-7-11-4-12(8-18)6-17(5-11,10-18)16(24)25-9-14(23)22-13-2-1-3-21-15(13)20/h1-3,11-12H,4-10H2,(H,22,23)/t11-,12+,17?,18? |
| InChIKey | CHDPNWWRKDOJPM-CCHVVGMOSA-N |
| XLogP | 3.95 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.73 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|